|
|
| | D-Luciferin, ethyl ester Basic information |
| Product Name: | D-Luciferin, ethyl ester | | Synonyms: | Ethyl (S)-4,5-dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylate;ethyl (2E,4S)-2-(6-oxo-1,3-benzothiazol-2-ylidene)-1,3-thiazolidine-4-carboxylate;4-Thiazolecarboxylic acid, 4,5-dihydro-2-(6-hydroxy-2-benzothiazolyl)-, ethyl ester, (S)- (9CI);Ethyl (S)-2-(6-hydroxybenzo[d]thiazol-2-yl)-4,5-dihydrothiazole-4-carboxylate;D-Luciferin, ethyl ester | | CAS: | 135251-85-3 | | MF: | C13H12N2O3S2 | | MW: | 308.38 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | D-Luciferin, ethyl ester Chemical Properties |
| Boiling point | 503.630±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.581±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | pka | 8.308±0.40(predicted) | | InChI | InChI=1S/C13H12N2O3S2/c1-2-18-13(17)9-6-19-11(15-9)12-14-8-4-3-7(16)5-10(8)20-12/h3-5,9,16H,2,6H2,1H3/t9-/m1/s1 | | InChIKey | GRKGOUVHSRHNDB-SECBINFHSA-N | | SMILES | S1C[C@H](C(OCC)=O)N=C1C1=NC2=CC=C(O)C=C2S1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 |
| | D-Luciferin, ethyl ester Usage And Synthesis |
| | D-Luciferin, ethyl ester Preparation Products And Raw materials |
|