- HEDTA
-
- $30.00 / 100g
-
2026-01-05
- CAS:150-39-0
- Min. Order:
- Purity: 99.86%
- Supply Ability: 10g
|
| | N-(2-Hydroxyethyl)ethylenediaminetriacetic acid Basic information |
| Product Name: | N-(2-Hydroxyethyl)ethylenediaminetriacetic acid | | Synonyms: | N-(2-HYDROXYETHYL)ETHYLENEDIAMINE-N,N,N''-TRIACETIC ACID (HEDTA);N-(2-Hydroxyethyl)ethylenediaminetriacetic acid, 98+%;HEDTA, HEEDTA, N-Carboxymethyl-Nμ-(2-hydroxyethyl)-N,Nμ-ethylenediglycine;(2-Hydroxyethyl)ethylenediaminetriacetic acid, trisodium salt;Trisodium hydroxyethyl ethylenediaminetriacetate;2-[Carboxymethyl(2-hydroxyethyl)amino]ethyliminodiacetic acid;N-(2-Hydroxyethyl)ethylenediaminetriacetic acid,99%;N-Carboxymethyl-N′-(2-hydroxyethyl)-N | | CAS: | 150-39-0 | | MF: | C10H18N2O7 | | MW: | 278.26 | | EINECS: | 205-759-3 | | Product Categories: | Analytical Chemistry;Chelating Reagents;Complexones;EDTA Analogs;150-39-0 | | Mol File: | 150-39-0.mol |  |
| | N-(2-Hydroxyethyl)ethylenediaminetriacetic acid Chemical Properties |
| Melting point | 212 °C (dec.)(lit.) | | Boiling point | 421.08°C (rough estimate) | | density | 1.3300 (rough estimate) | | vapor pressure | 0.01Pa at 20℃ | | refractive index | 1.4550 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | 3 M NaOH: 0.1 M, clear, colorless | | pka | pK1:2.39;pK2:5.37;pK3:9.93 (25°C) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | soluble | | BRN | 1804795 | | Cosmetics Ingredients Functions | BULKING
CHELATING
ABSORBENT
OPACIFYING
VISCOSITY CONTROLLING | | Cosmetic Ingredient Review (CIR) | N-(2-Hydroxyethyl)ethylenediaminetriacetic acid (150-39-0) | | InChI | 1S/C10H18N2O7/c13-4-3-11(5-8(14)15)1-2-12(6-9(16)17)7-10(18)19/h13H,1-7H2,(H,14,15)(H,16,17)(H,18,19) | | InChIKey | URDCARMUOSMFFI-UHFFFAOYSA-N | | SMILES | OCCN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | | LogP | -4.65 at 20℃ | | CAS DataBase Reference | 150-39-0(CAS DataBase Reference) | | EPA Substance Registry System | (2-Hydroxyethyl)ethylenediaminetriacetic acid (150-39-0) |
| | N-(2-Hydroxyethyl)ethylenediaminetriacetic acid Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | Chelating compound. | | Uses | N-(2-Hydroxyethyl)ethylenediaminetriacetic acid is a chelating agent. | | in vivo | EDTA-OH (50 mg/kg, i.p. for 5 days) decreases the aluminium concentration in blood and brain and oxidative stress in brain. EDTA-OH is blood-brain barrier permeable, which could be an antidote for aluminium overload[3]. | Animal Model: | Aluminium overload in wistar rats[3] | | Dosage: | 50 mg/kg | | Administration: | i.p. for 5 days | | Result: | Inhibited GST activity, reduced the concentration of aluminium in blood and brain. |
| | Purification Methods | Crystallise HEDTA from warm H2O, after filtering, by addition of 95% EtOH and allowing to cool. The crystals, collected on a sintered-glass funnel, are washed three times with cold absolute EtOH, then again crystallised from H2O. After leaching with cold H2O, the crystals are dried at 100o under vacuum. [Spedding et al. J Am Chem Soc 78 34 1956, Beilstein 4 IV 2449.] |
| | N-(2-Hydroxyethyl)ethylenediaminetriacetic acid Preparation Products And Raw materials |
|