| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(4R,5S)-(?)-1,5-DiMethyl-4-phenyl-2-iMidazolidinone CAS:92841-65-1 Purity:97% Package:1G
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Products Intro: |
Product Name:(4R 5S)-1 5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDONE CAS:92841-65-1 Purity:98% Package:按需包装
|
(4R 5S)-1 5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDONE manufacturers
|
| | (4R 5S)-1 5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDONE Basic information |
| Product Name: | (4R 5S)-1 5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDONE | | Synonyms: | (4R,5S)-(-)-1,5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDINONE;(4R 5S)-1 5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDONE;(4R,5S)-1,5-DIMETHYL-4-PHENYLIMIDAZOLIDINONE;1,5-dimethyl-4-phenyl-2-imidazolidine;(4R)-4α-Phenyl-1,5α-dimethylimidazolidine-2-one;(4R,5S)-1,5-Dimethyl-4-phenylimidazolidine-2-one;[4R,5S,(-)]-1,5-Dimethyl-4-phenylimidazolidin-2-one;(4R,5S)-(-)-1,5-DiMethyl-4-phenyl-2-iMidazolidinone 97% | | CAS: | 92841-65-1 | | MF: | C11H14N2O | | MW: | 190.24 | | EINECS: | | | Product Categories: | Chiral Building Blocks;Heterocyclic Building Blocks;Imidazolines/Imidazolidines | | Mol File: | 92841-65-1.mol |  |
| | (4R 5S)-1 5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDONE Chemical Properties |
| Melting point | 171-174 °C(lit.) | | Boiling point | 335.9±17.0 °C(Predicted) | | density | 1.077±0.06 g/cm3(Predicted) | | form | solid | | pka | 13.70±0.60(Predicted) | | Optical Rotation | [α]20/D 42°, c = 1 in methanol | | BRN | 3607899 | | InChI | 1S/C11H14N2O/c1-8-10(12-11(14)13(8)2)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,12,14)/t8-,10-/m0/s1 | | InChIKey | BGPAZBKCZVVZGF-WPRPVWTQSA-N | | SMILES | C[C@H]1[C@H](NC(=O)N1C)c2ccccc2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (4R 5S)-1 5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDONE Usage And Synthesis |
| Uses | Employed in the synthesis of optically active mono-, di-, and trihydroxy compounds. |
| | (4R 5S)-1 5-DIMETHYL-4-PHENYL-2-IMIDAZOLIDONE Preparation Products And Raw materials |
|