|
|
| | 1-Boc-4-Methylaminopiperidine Basic information |
| Product Name: | 1-Boc-4-Methylaminopiperidine | | Synonyms: | N-BOC-4-METHYLAMINOPIERIDINE;N-BOC-4-METHYLAMINOPIPERIDINE;N-BOC-4-N-METHYLAMINO PIPERIDINE;4-N-METHYLAMINO-1-BOC-PIPERIDINE;4-METHYLAMINO-PIPERIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;BUTTPARK 90\06-11;1-N-BOC-4-(METHYLAMINO)PIPERIDINE;1-BOC-4-METHYLAMINOPIPERIDINE | | CAS: | 147539-41-1 | | MF: | C11H22N2O2 | | MW: | 214.31 | | EINECS: | | | Product Categories: | pharmacetical;Piperidine | | Mol File: | 147539-41-1.mol |  |
| | 1-Boc-4-Methylaminopiperidine Chemical Properties |
| Boiling point | 289.0±33.0 °C(Predicted) | | density | 1.005 g/mL at 25 °C | | refractive index | n20/D1.468 | | Fp | >110℃ | | storage temp. | 2-8°C | | pka | 10.19±0.20(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-7-5-9(12-4)6-8-13/h9,12H,5-8H2,1-4H3 | | InChIKey | CZYUGTLMFHDODF-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(NC)CC1 | | CAS DataBase Reference | 147539-41-1(CAS DataBase Reference) |
| Hazard Codes | Xi,N,T | | Risk Statements | 36/37/38-50-25 | | Safety Statements | 26-61-45-36/37/39 | | RIDADR | 2810 | | WGK Germany | 3 | | F | 10-34 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 29339900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-Boc-4-Methylaminopiperidine Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 1-Boc-4-(methylamino)piperidine is used as an organic chemical synthesis intermediate. | | Uses | 1-Boc-4-methylaminopiperidine is a derivatieve of 3-Methylaminopiperidine Dihydrochloride, which is a a key intermediate for the antibacterial agent balofloxacin. | | Synthesis | GENERAL STEPS: To a suspension of N-Boc-4-piperidone (10.00 g, 50.19 mmol) in ethanol (75 mL) was added 10% Pd/C catalyst (1.00 g, 10 wt%), methylamine (33% ethanol solution, 27 mL, 0.20 mol) and formic acid (46 mg, 1.00 mmol). The reaction mixture was placed in an autoclave, sealed under a hydrogen atmosphere at 4 MPa and stirred at 50°C overnight. After completion of the reaction, it was cooled to room temperature and filtered to remove the catalyst. The filtrate was concentrated in vacuum to afford 1-Boc-4-(methylamino)piperidine as a pale yellow liquid (10.70 g, 99% yield). Mass spectrum (ESI, cation mode) m/z: 215.3 [M + H]+; 1H NMR (400 MHz, CDCl3): δ (ppm) 4.01 (m, 2H), 2.79 (m, 2H), 2.48 (m, 1H), 2.42 (s, 3H), 1.83 (m, 2H), 1.44 (s, 9H), 1.28-1.15 (m, 2H). | | References | [1] Patent: WO2015/73267, 2015, A1. Location in patent: Paragraph 332
[2] Patent: CN104650092, 2017, B. Location in patent: Paragraph 0533-0536
[3] Patent: US2006/160786, 2006, A1. Location in patent: Page/Page column 32
[4] Bioorganic and Medicinal Chemistry Letters, 2014, vol. 24, # 17, p. 4281 - 4285
[5] Patent: WO2005/7645, 2005, A1. Location in patent: Page 77 |
| | 1-Boc-4-Methylaminopiperidine Preparation Products And Raw materials |
|