| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | Bicyclo[1.1.1]pentan-1-amine Basic information |
| | Bicyclo[1.1.1]pentan-1-amine Chemical Properties |
| Boiling point | 108.0±8.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | pka | 10.97±0.20(Predicted) | | InChI | InChI=1S/C5H9N/c6-5-1-4(2-5)3-5/h4H,1-3,6H2 | | InChIKey | UZDGSLINNQQTJM-UHFFFAOYSA-N | | SMILES | C12(N)CC(C1)C2 |
| | Bicyclo[1.1.1]pentan-1-amine Usage And Synthesis |
| Uses | Bicyclo[1.1.1]pentan-1-amine is a reagent useful in a variety of synthesis. In particular, it is used in the prepartion of 2,4-diaminopyrimidines which are histamine H4 receptor ligands. |
| | Bicyclo[1.1.1]pentan-1-amine Preparation Products And Raw materials |
|