|
|
| | Ethyl 2-aminothiazole-5-carboxylate Basic information |
| | Ethyl 2-aminothiazole-5-carboxylate Chemical Properties |
| Melting point | 144-148 | | Boiling point | 308.0±15.0 °C(Predicted) | | density | 1.336±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Water Solubility | Insoluble in water | | form | powder to crystal | | pka | 3.12±0.10(Predicted) | | color | White to Yellow to Orange | | λmax | 299nm(EtOH)(lit.) | | Sensitive | Moisture & Light Sensitive | | InChI | InChI=1S/C6H8N2O2S/c1-2-10-5(9)4-3-8-6(7)11-4/h3H,2H2,1H3,(H2,7,8) | | InChIKey | VNZXERIGKZNEKB-UHFFFAOYSA-N | | SMILES | S1C(C(OCC)=O)=CN=C1N | | CAS DataBase Reference | 32955-21-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 2 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 2-aminothiazole-5-carboxylate Usage And Synthesis |
| Chemical Properties | White to yellow or light brown crystal or powder | | Uses | 2-Amino-5-thiazolecarboxylic Acid Ethyl Ester is used in the synthesis of dual-action antidiabetic agents that inhibit glycogen phosphorylase. | | Synthesis Reference(s) | Tetrahedron Letters, 42, p. 2101, 2001 DOI: 10.1016/S0040-4039(01)00161-7 | | Synthesis | 1. N-bromosuccinimide (19.6 g, 0.11 mol) was slowly added to a water/dioxane (1:1, 100 mL) solution of ethyl 3-ethoxyacrylate (14.4 g, 0.1 mol) at -10 °C. 2. The reaction mixture was stirred at room temperature for 1 h. 3. After the addition of thiourea (7.6 g, 0.1 mol), the reaction mixture was was heated to 80 °C and maintained for 1 h. 4. Upon completion of the reaction, the solution was cooled to room temperature followed by the addition of ammonia (20 mL). 5. The resulting paste was stirred at room temperature for 10 min and then filtered. 6. The filter cake was washed with water and dried under vacuum to give the final product, ethyl 2-aminothiazole-5-carboxylate (12.1 g, 70% yield). | | References | [1] Patent: EP2615092, 2013, A1. Location in patent: Paragraph 0095; 0096
[2] Patent: WO2006/8556, 2006, A1. Location in patent: Page/Page column 20-21 |
| | Ethyl 2-aminothiazole-5-carboxylate Preparation Products And Raw materials |
|