| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine Basic information |
| Product Name: | N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine | | Synonyms: | N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine;N4,N4' -Bis(9,9-dimethyl-9H -fluoren-2-yl)-N4,N4'-diphenylbiphenyl-4,4'-diamine;N4,N4,-bis(9,9-dimethyl-9H-fluoren-2-yl)-N4,N4,-diphenyl-[1,1,-biphenyl]-4,4,-diamine;N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine;BF-DPB;[1,1'-Biphenyl]-4,4'-diamine, N4,N4'-bis(9,9-dimethyl-9H-fluoren-2-yl)-N4,N4'-diphenyl-;N,N'-Diphenyl-N,N'-bis(9,9,-dimethylfluorenyl)benzidine;N,N'-diphenyl-N,N'-bis(9,9-dimethylfluoren-2-yl)benzidine | | CAS: | 361486-60-4 | | MF: | C54H44N2 | | MW: | 720.94 | | EINECS: | | | Product Categories: | | | Mol File: | 361486-60-4.mol |  |
| | N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine Chemical Properties |
| Melting point | 264 °C | | density | 1.178±0.06 g/cm3(Predicted) | | pka | -2.49±0.40(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChIKey | VZYZZKOUCVXTOJ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N(C3C=CC4C5=C(C(C)(C)C=4C=3)C=CC=C5)C3=CC=CC=C3)C=C2)=CC=C(N(C2C=CC3C4=C(C(C)(C)C=3C=2)C=CC=C4)C2=CC=CC=C2)C=C1 |
| | N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine Usage And Synthesis |
| | N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine Preparation Products And Raw materials |
|