|
|
| | Salmeterol EP Impurity A Basic information |
| Product Name: | Salmeterol EP Impurity A | | Synonyms: | Salmeterol EP Impurity A;CDECXFLVJCMIAL-UHFFFAOYSA-N;Salmeterol Impurity 2(Salmeterol EP Impurity A );1,3-Benzenedimethanol, 4-hydroxy-α1-[[(4-phenylbutyl)amino]methyl]-;Salmeterol Impurity 2(EP Impurity A );1-(RS)-1-[4-Hydroxy-3-(Hydroxymethylphenyl]-2-[(4-phenylbutyl)aminoethanol (Salmeterol EP Impurity A);Salmeterol?EP Impurity A/ Salmeterol Related Compound A;Salmeterol Related Compound A (4-[1-Hydroxy-2-(4-phenylbutylamino)ethyl]-2-(hydroxymethyl)phenol) (1609614) | | CAS: | 1798014-51-3 | | MF: | C19H25NO3 | | MW: | 315.41 | | EINECS: | | | Product Categories: | | | Mol File: | 1798014-51-3.mol |  |
| | Salmeterol EP Impurity A Chemical Properties |
| Boiling point | 538.8±50.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | pka | 9.99±0.31(Predicted) | | InChI | InChI=1S/C19H25NO3/c21-14-17-12-16(9-10-18(17)22)19(23)13-20-11-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-10,12,19-23H,4-5,8,11,13-14H2 | | InChIKey | CDECXFLVJCMIAL-UHFFFAOYSA-N | | SMILES | C(C1C=CC(O)=C(CO)C=1)(O)CNCCCCC1C=CC=CC=1 |
| | Salmeterol EP Impurity A Usage And Synthesis |
| Uses | 1-(RS)-1-[4-Hydroxy-3-(Hydroxymethylphenyl]-2-[(4-phenylbutyl)aminoethanol is an impurity in the synthesis of Salmetrol EP (S090100), a β2-Adrenergic agonist. Structural analog of Albuterol (A514500). |
| | Salmeterol EP Impurity A Preparation Products And Raw materials |
|