|
|
| | Urushiol (15:3) Basic information |
| Product Name: | Urushiol (15:3) | | Synonyms: | Urushiol (15:3);1,2-Benzenediol, 3-(8Z,11Z)-8,11,14-pentadecatrien-1-yl-;Urushiol (15:3)-RM;3-(8Z,11Z,14-Pentadecatrienyl)-1,2-benzenediol;Urushiol (15:3) (Standard) | | CAS: | 83543-37-7 | | MF: | C21H30O2 | | MW: | 314.46 | | EINECS: | | | Product Categories: | | | Mol File: | 83543-37-7.mol |  |
| | Urushiol (15:3) Chemical Properties |
| storage temp. | -20°C | | Major Application | food and beverages | | InChI | 1S/C21H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(22)21(19)23/h2,4-5,7-8,15,17-18,22-23H,1,3,6,9-14,16H2/b5-4-,8-7- | | InChIKey | RUWDFSXBACIZCV-UTOQUPLUSA-N | | SMILES | Oc1c(cccc1CCCCCCC\C=C/C\C=C/CC=C)O |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Sens. 1 |
| | Urushiol (15:3) Usage And Synthesis |
| | Urushiol (15:3) Preparation Products And Raw materials |
|