|
|
| | 2,3-Dichlorothiophene-5-sulfonamide Basic information |
| Product Name: | 2,3-Dichlorothiophene-5-sulfonamide | | Synonyms: | 4,5-DICHLORO-2-THIOPHENESULFONAMIDE;2,3-DICHLOROTHIOPHENE-5-SULFONAMIDE;2,3-DICHLORO THIOPHENE-5-SULFONAMIDE 98.0%MIN;4,5-Dichlorothiophene-2-sulfonamide;2,3-Dichlorothiophene-5-sulfonamide, 97.5%;2-Thiophenesulfonamide, 4,5-dichloro-;2,3-Dichlorothiophene-5-sulfomide | | CAS: | 256353-34-1 | | MF: | C4H3Cl2NO2S2 | | MW: | 232.11 | | EINECS: | | | Product Categories: | Heterocycle-oher series | | Mol File: | 256353-34-1.mol |  |
| | 2,3-Dichlorothiophene-5-sulfonamide Chemical Properties |
| Melting point | 152-155°C | | Boiling point | 405.3±55.0 °C(Predicted) | | density | 1.761±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | form | solid | | pka | 9.48±0.60(Predicted) | | Appearance | gray solid | | InChI | 1S/C4H3Cl2NO2S2/c5-2-1-3(10-4(2)6)11(7,8)9/h1H,(H2,7,8,9) | | InChIKey | JKBNSTFOQDGQLS-UHFFFAOYSA-N | | SMILES | NS(=O)(=O)c1cc(Cl)c(Cl)s1 | | CAS DataBase Reference | 256353-34-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,3-Dichlorothiophene-5-sulfonamide Usage And Synthesis |
| Chemical Properties | Tan solid |
| | 2,3-Dichlorothiophene-5-sulfonamide Preparation Products And Raw materials |
|