| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 4008675858 |
| Email: |
sales@amateksci.com |
| Products Intro: |
Product Name:3-(2-Aminoethyl)benzoic acid methyl ester HCl CAS:167846-36-8 Purity:97% HPLC Package:1g;5g;25g;100g
|
|
| | 3-(2-Aminoethyl)benzoic acid methyl ester HCl Basic information |
| | 3-(2-Aminoethyl)benzoic acid methyl ester HCl Chemical Properties |
| Melting point | 145 -150°C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C10H13NO2.ClH/c1-13-10(12)9-4-2-3-8(7-9)5-6-11;/h2-4,7H,5-6,11H2,1H3;1H | | InChIKey | BGAZMFTXUBRZLI-UHFFFAOYSA-N | | SMILES | C(C1C=CC=C(CCN)C=1)(=O)OC.Cl |
| | 3-(2-Aminoethyl)benzoic acid methyl ester HCl Usage And Synthesis |
| Uses | 3-(2-Aminoethyl)benzoic Acid Methyl Ester (cas# 179003-00-0) is a compound useful in organic synthesis. It could be used for the preparation of isothiocyanates, which are anticancer agents. |
| | 3-(2-Aminoethyl)benzoic acid methyl ester HCl Preparation Products And Raw materials |
|