3,5-Dimethoxy-4-isopropyl-trans-stilbene manufacturers
|
| | 3,5-Dimethoxy-4-isopropyl-trans-stilbene Basic information |
| Product Name: | 3,5-Dimethoxy-4-isopropyl-trans-stilbene | | Synonyms: | 3,5-Dimethoxy-4-isopropyl-trans-stilbene;Benzene, 1,3-dimethoxy-2-(1-methylethyl)-5-[(1E)-2-phenylethenyl]-;(E)-2-Isopropyl-1,3-dimethoxy-5-styrylbenzene;Benvitimod Impurity 5;Benvitimod Impurity 12;Tapinarof Impurity 2 | | CAS: | 141509-20-8 | | MF: | C19H22O2 | | MW: | 282.38 | | EINECS: | | | Product Categories: | | | Mol File: | 141509-20-8.mol |  |
| | 3,5-Dimethoxy-4-isopropyl-trans-stilbene Chemical Properties |
| Boiling point | 426.7±34.0 °C(Predicted) | | density | 1.043±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C19H22O2/c1-14(2)19-17(20-3)12-16(13-18(19)21-4)11-10-15-8-6-5-7-9-15/h5-14H,1-4H3/b11-10+ | | InChIKey | FXVZTPXCRKMNJO-ZHACJKMWSA-N | | SMILES | C1(OC)=CC(/C=C/C2=CC=CC=C2)=CC(OC)=C1C(C)C |
| | 3,5-Dimethoxy-4-isopropyl-trans-stilbene Usage And Synthesis |
| | 3,5-Dimethoxy-4-isopropyl-trans-stilbene Preparation Products And Raw materials |
|