- SW044248
-
- $35.00 / 5mg
-
2026-04-16
- CAS:522650-83-5
- Min. Order:
- Purity: 99.87%
- Supply Ability: 10g
|
| | 2-(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-ylthio)-N-(2-methoxyphenyl)butanamide Basic information |
| Product Name: | 2-(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-ylthio)-N-(2-methoxyphenyl)butanamide | | Synonyms: | SW 044248;SW044248;CS-2302;SW-044248, >98%;2-(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-ylthio)-N-(2-methoxyphenyl)butanamide;SW-044248; 2-(5-Ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)-N-(2-methoxy-phenyl )-butyramide;Butanamide, 2-[(5-ethyl-5H-1,2,4-triazino[5,6-b]indol-3-yl)thio]-N-(2-methoxyphenyl)-;SW044248 >=98% (HPLC) | | CAS: | 522650-83-5 | | MF: | C22H23N5O2S | | MW: | 421.52 | | EINECS: | | | Product Categories: | | | Mol File: | 522650-83-5.mol | ![2-(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-ylthio)-N-(2-methoxyphenyl)butanamide Structure](CAS/20180703/GIF/522650-83-5.gif) |
| | 2-(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-ylthio)-N-(2-methoxyphenyl)butanamide Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO:10.5(Max Conc. mg/mL);24.91(Max Conc. mM) DMF:5.0(Max Conc. mg/mL);11.86(Max Conc. mM) Ethanol:1.0(Max Conc. mg/mL);2.37(Max Conc. mM) | | form | powder | | color | white to beige | | SMILES | CCC(C(NC1=C(OC)C=CC=C1)=O)SC2=NC(N(CC)C3=C4C=CC=C3)=C4N=N2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-ylthio)-N-(2-methoxyphenyl)butanamide Usage And Synthesis |
| Uses | 2-((5-Ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)thio)-N-(2-methoxyphenyl)butanamide is a useful intermediate for organic synthesis and other chemical processes. | | Biochem/physiol Actions | SW044248 is a cell permeable, indolotriazine-based compound that selectively inhibits topoisomerase 1 (Top 1), but not Top 2, catalyzed DNA decatenation in a manner distinct from that of camptothecin (Cat. Nos. 208925 & C9911). SW044248 is shown to exhibit antiproliferation efficacy against a subset of non-small-cell lung cancer (NSCLC) cultures (IC50 <5>10 μM) derived from the same patient as HCC4017. | | IC 50 | Topoisomerase I |
| | 2-(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-ylthio)-N-(2-methoxyphenyl)butanamide Preparation Products And Raw materials |
|