| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- m-PEG4-amido-Mal
-
-
2025-06-07
- CAS:1263044-81-0
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | m-PEG4-Mal Basic information |
| Product Name: | m-PEG4-Mal | | Synonyms: | Mal-amido-PEG4-Ome;m-PEG4-Mal;m-dPEG(R)4-MAL;Methyl-PEG4-Maleimide;m-PEG4-amino-Mal;1H-Pyrrole-1-propanamide, 2,5-dihydro-2,5-dioxo-N-3,6,9,12-tetraoxatridec-1-yl-;mPEG4-Maleimide;m-dPEG??-MAL | | CAS: | 1263044-81-0 | | MF: | C16H26N2O7 | | MW: | 358.39 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1263044-81-0.mol |  |
| | m-PEG4-Mal Chemical Properties |
| storage temp. | -20°C | | form | solid or viscous liquid | | InChIKey | DOHTYEHHGXSUJO-UHFFFAOYSA-N | | SMILES | O=C1C=CC(N1CCC(NCCOCCOCCOCCOC)=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | m-PEG4-Mal Usage And Synthesis |
| Description | m-PEG4-Mal is a PEG linker containing a maleimide group. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | m-PEG4-amino-Mal is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | reaction suitability | reactivity: thiol reactive
reagent type: chemical modification reagent
reagent type: cross-linking reagent
reactivity: sulfhydryl reactive | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | m-PEG4-Mal Preparation Products And Raw materials |
|