| Company Name: |
DebyeTec.com Inc.
|
| Tel: |
18-086626237 18086626237 |
| Email: |
2693528373@qq.com |
| Products Intro: |
Product Name:4-(2-methoxyphenyl)-1-butanol CAS:10493-38-6 Purity:95+% Package:1g;25g;100g;1kg;
|
| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:2-Methoxy-benzenebutanol CAS:10493-38-6 Purity:97% HPLC Package:1g;5g;25g;100g
|
| Company Name: |
LABTER SCIENTIFIC CO.,LTD
|
| Tel: |
010-56330744 15210344275 |
| Email: |
sales@labter.com.cn |
| Products Intro: |
Product Name:2-METHOXY-BENZENEBUTANOL CAS:10493-38-6 Purity:95% HPLC Package:1g;5g;10g;25g;100g;250g;500g;1kg;5kg;10kg
|
|
| | Benzenebutanol, 2-methoxy-
Basic information | | Uses |
| | Benzenebutanol, 2-methoxy-
Chemical Properties |
| storage temp. | Store at Room Tem. | | InChI | InChI=1S/C11H16O2/c1-13-11-8-3-2-6-10(11)7-4-5-9-12/h2-3,6,8,12H,4-5,7,9H2,1H3 | | InChIKey | LICCCCCCEBHYTF-UHFFFAOYSA-N | | SMILES | C1(CCCCO)=CC=CC=C1OC |
| | Benzenebutanol, 2-methoxy-
Usage And Synthesis |
| Uses | 4-(2-Methoxyphenyl)but-1-ol is an organic alcohol compound that can be used as an intermediate in pharmaceutical and chemical synthesis. |
| | Benzenebutanol, 2-methoxy-
Preparation Products And Raw materials |
|