| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | Benzenebutanol, 2-methoxy-
Basic information | | Uses |
| | Benzenebutanol, 2-methoxy-
Chemical Properties |
| storage temp. | Store at Room Tem. | | InChI | InChI=1S/C11H16O2/c1-13-11-8-3-2-6-10(11)7-4-5-9-12/h2-3,6,8,12H,4-5,7,9H2,1H3 | | InChIKey | LICCCCCCEBHYTF-UHFFFAOYSA-N | | SMILES | C1(CCCCO)=CC=CC=C1OC |
| | Benzenebutanol, 2-methoxy-
Usage And Synthesis |
| Uses | 4-(2-Methoxyphenyl)but-1-ol is an organic alcohol compound that can be used as an intermediate in pharmaceutical and chemical synthesis. |
| | Benzenebutanol, 2-methoxy-
Preparation Products And Raw materials |
|