4'-(diphenylamino)-[1,1'-biphenyl]-4-carbaldehyde manufacturers
|
| | 4'-(diphenylamino)-[1,1'-biphenyl]-4-carbaldehyde Basic information | | Uses |
| Product Name: | 4'-(diphenylamino)-[1,1'-biphenyl]-4-carbaldehyde | | Synonyms: | 4'-(diphenylamino)-[1,1'-biphenyl]-4-carbaldehyde;[1,1'-Biphenyl]-4-carboxaldehyde, 4'-(diphenylamino)-;4'-(Diphenylamino)biphenyl-4-carbaldehyde;4-[4-(N-phenylanilino)phenyl]benzaldehyde;4'-(dibenzeneamino)-[1,1'-biphenyl]-4-methylaldehyde | | CAS: | 133878-93-0 | | MF: | C25H19NO | | MW: | 349.42 | | EINECS: | | | Product Categories: | | | Mol File: | 133878-93-0.mol | ![4'-(diphenylamino)-[1,1'-biphenyl]-4-carbaldehyde Structure](CAS/20180703/GIF/133878-93-0.gif) |
| | 4'-(diphenylamino)-[1,1'-biphenyl]-4-carbaldehyde Chemical Properties |
| Boiling point | 530.2±43.0 °C(Predicted) | | density | 1.174±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | -3.40±0.60(Predicted) | | Appearance | Light yellow to green yellow Solid | | InChI | InChI=1S/C25H19NO/c27-19-20-11-13-21(14-12-20)22-15-17-25(18-16-22)26(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-19H | | InChIKey | OFGINXFWJLDDPY-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N(C3=CC=CC=C3)C3=CC=CC=C3)C=C2)=CC=C(C=O)C=C1 |
| | 4'-(diphenylamino)-[1,1'-biphenyl]-4-carbaldehyde Usage And Synthesis |
| Uses | 4'-(diphenylamine)-[1,1'-biphenyl]-4-carboxaldehyde is an aldehyde derivative used in organic synthesis and scientific research experiments. |
| | 4'-(diphenylamino)-[1,1'-biphenyl]-4-carbaldehyde Preparation Products And Raw materials |
|