| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
+86-(0)57185586718; +8613336195806 |
| Email: |
sales@capot.com |
| Products Intro: |
Product Name:4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborlan-2-yl)toluene CAS:195062-57-8 Purity:98%(Min,HPLC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)TOLUENE Basic information |
| Product Name: | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)TOLUENE | | Synonyms: | 4-METHYLPHENYLBORONIC ACID, PINACOL ESTER;4-Methylbenzeneboronic acid, pinacol ester;2-(4-Methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4,4,5,5-tetramethyl-2-(4-methylphenyl)-1,3,2-dioxaborolane;Bm017;4,4,5,5-tetramethyl-2-p-tolyl-1,3,2-dioxaborolane;4-Methylphentlboronic acid pinacol ester;4-Tolylboronic acid pinacol ester | | CAS: | 195062-57-8 | | MF: | C13H19BO2 | | MW: | 218.1 | | EINECS: | | | Product Categories: | | | Mol File: | 195062-57-8.mol |  |
| | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)TOLUENE Chemical Properties |
| Melting point | 53.3-54.0°C | | Boiling point | 298.2±19.0 °C(Predicted) | | density | 0.98±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Toluene | | form | powder to lump | | color | White to Almost white | | InChI | 1S/C13H19BO2/c1-10-6-8-11(9-7-10)14-15-12(2,3)13(4,5)16-14/h6-9H,1-5H3 | | InChIKey | GKSSEDDAXXEPCP-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)B2OC(C)(C)C(C)(C)O2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)TOLUENE Usage And Synthesis |
| Uses | suzuki reaction | | Uses | 4,4,5,5-Tetramethyl-2-(4-methylphenyl)dioxaborolane is used in the synthesis of antimicrobial compounds, showing gram-negatice activity. Also used in the synthesis of component chemicals to thin-film transistors. |
| | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)TOLUENE Preparation Products And Raw materials |
|