|
|
| | EXO-2-BROMONORBORNANE Basic information |
| Product Name: | EXO-2-BROMONORBORNANE | | Synonyms: | 2-Bromobicyclo[2.2.1]heptane;2-exo-Norbornyl bromide;Bicyclo[2.2.1]heptane, 2-bromo-, exo-;exo-Norbornyl bromide;Norbornane, 2-bromo-, exo-;EXO-2-BROMOBICYCLO[2.2.1]HEPTANE;EXO-2-BROMONORBORNANE;(1R,3S,4S)-3-bromobicyclo[2.2.1]heptane | | CAS: | 2534-77-2 | | MF: | C7H11Br | | MW: | 175.07 | | EINECS: | 219-798-9 | | Product Categories: | CYCLOPENTANE | | Mol File: | 2534-77-2.mol |  |
| | EXO-2-BROMONORBORNANE Chemical Properties |
| Boiling point | 82 °C29 mm Hg(lit.) | | density | 1.363 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5148(lit.) | | Fp | 140 °F | | storage temp. | Storage temp. 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C7H11Br/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7+/m1/s1 | | InChIKey | QXYOAWHKJRWNID-VQVTYTSYSA-N | | SMILES | Br[C@H]1C[C@@H]2CC[C@H]1C2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-26 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29035980 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | EXO-2-BROMONORBORNANE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID |
| | EXO-2-BROMONORBORNANE Preparation Products And Raw materials |
|