|
|
| | 2-(2-BroMophenyl)-9H-phenylcarbazole Basic information |
| | 2-(2-BroMophenyl)-9H-phenylcarbazole Chemical Properties |
| Melting point | 104.0 to 108.0 °C | | Boiling point | 550.1±32.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C24H16BrN/c25-22-12-6-4-10-19(22)17-14-15-21-20-11-5-7-13-23(20)26(24(21)16-17)18-8-2-1-3-9-18/h1-16H | | InChIKey | DUNRZHFGIQTWFF-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2)C2=C(C=CC=C2)C2=C1C=C(C1=CC=CC=C1Br)C=C2 |
| | 2-(2-BroMophenyl)-9H-phenylcarbazole Usage And Synthesis |
| Uses |
2-(2-BroMophenyl)-9H-phenylcarbazole can be used as a pharmaceutical intermediate in pharmaceutical synthesis and experimental research.
|
| | 2-(2-BroMophenyl)-9H-phenylcarbazole Preparation Products And Raw materials |
|