|
|
| | chlorocarbonic acid-(1-methyl-pentyl ester) Basic information |
| Product Name: | chlorocarbonic acid-(1-methyl-pentyl ester) | | Synonyms: | chlorocarbonic acid-(1-methyl-pentyl ester);Dabigatran Impurity 35;Dabigatran Impurity 70;hexan-2-yl carbonochloridate;Dabigatran Etexilate iMpurity 41;Chlorine formic acid - 1 - methyl amyl;Carbonochloridic acid, 1-methylpentyl ester;Dabigatran Impurity 41 | | CAS: | 265659-62-9 | | MF: | C7H13ClO2 | | MW: | 164.63 | | EINECS: | | | Product Categories: | | | Mol File: | 265659-62-9.mol |  |
| | chlorocarbonic acid-(1-methyl-pentyl ester) Chemical Properties |
| Boiling point | 180.9±9.0 °C(Predicted) | | density | 1.033±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C7H13ClO2/c1-3-4-5-6(2)10-7(8)9/h6H,3-5H2,1-2H3 | | InChIKey | ZLKKDYSCTUTSNA-UHFFFAOYSA-N | | SMILES | C(Cl)(OC(C)CCCC)=O |
| | chlorocarbonic acid-(1-methyl-pentyl ester) Usage And Synthesis |
| | chlorocarbonic acid-(1-methyl-pentyl ester) Preparation Products And Raw materials |
|