|
|
| | 2,3,5-TRI-O-BENZYL-D-ARABINOFURANOSE Basic information |
| Product Name: | 2,3,5-TRI-O-BENZYL-D-ARABINOFURANOSE | | Synonyms: | 2,3,5-TRI-O-BENZYL-(ALPHA)-D-ARABINOFURANOSE;2,3,5-Tri-O-benzyl-D-arabinofurannose;2,3,5-tri-O-benzyl-D-arabinofuranose BETA;2,3,5-TRI-O-BENZYL-D-ARABINOFURANOSE;2,3,5-tri-O-benzyl-D-arabinose;D-Arabinose, 2,3,5-tris-O-(phenylmethyl)-;(3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol;(2S,3R,4R)-2,3,5-tris(benzyloxy)-4-hydroxypentanal | | CAS: | 37776-25-3 | | MF: | C26H28O5 | | MW: | 420.5 | | EINECS: | | | Product Categories: | | | Mol File: | 37776-25-3.mol |  |
| | 2,3,5-TRI-O-BENZYL-D-ARABINOFURANOSE Chemical Properties |
| Melting point | 65-67°C | | Boiling point | 591.5±50.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 13.28±0.20(Predicted) | | form | Powder | | color | White to Off-white | | InChI | InChI=1S/C26H28O5/c27-16-25(30-18-22-12-6-2-7-13-22)26(31-19-23-14-8-3-9-15-23)24(28)20-29-17-21-10-4-1-5-11-21/h1-16,24-26,28H,17-20H2/t24-,25-,26-/m1/s1 | | InChIKey | XUCNSIRQCBFBHF-TWJOJJKGSA-N | | SMILES | O=C[C@H]([C@@H]([C@@H](COCC1=CC=CC=C1)O)OCC1=CC=CC=C1)OCC1=CC=CC=C1 |
| | 2,3,5-TRI-O-BENZYL-D-ARABINOFURANOSE Usage And Synthesis |
| Uses | 2,3,5-Tri-O-benzyl-D-arabinofuranose is an aldopentose sugar that functions as an intermediate in the synthesis of phosphono analog of N-acetyl-α-D-mannosamine 1-phosphate from D-arabinose. |
| | 2,3,5-TRI-O-BENZYL-D-ARABINOFURANOSE Preparation Products And Raw materials |
|