| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | L-Aspartic acid (1,4-13C2) Basic information |
| | L-Aspartic acid (1,4-13C2) Chemical Properties |
| Melting point | >300°C (dec.) (lit.) | | storage temp. | Store at -20°C | | form | Solid | | color | White to off-white | | InChI | 1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/i3+1,4+1 | | InChIKey | CKLJMWTZIZZHCS-CQDYUVAPSA-N | | SMILES | NC(C[13C](O)=O)[13C](O)=O | | CAS Number Unlabeled | 56-84-8 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Aspartic acid (1,4-13C2) Usage And Synthesis |
| Uses | L-Aspartic acid-1,4-13C2 is the 13C-labeled L-Aspartic acid. L-Aspartic acid is is an amino acid, shown to be a suitable proagent for colon-specific agent deliverly. | | Definition | ChEBI: Aspartic acid-1,4-(13)C2 is a (13)C-modified compound that is apspartic acid in which the carbon atoms at postions 1 and 4 are present as their (13)C isotopes. It is a (13)C-modified compound and an aspartic acid. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Aspartic acid (1,4-13C2) Preparation Products And Raw materials |
|