|
|
| | 6-BENZYL-OCTAHYDRO-PYRROLO[3,4-B]PYRIDINE Basic information |
| Product Name: | 6-BENZYL-OCTAHYDRO-PYRROLO[3,4-B]PYRIDINE | | Synonyms: | 6-BENZYL-OCTAHYDRO-PYRROLO[3,4-B]PYRIDINE;6-Benzyl-1H-octahydropyrrolo[3,4-b]pyridine;6-Benzyl-octahydro-pyrrolo[3,4-b]pyridine 2HCl;Octahydro-6-(phenylMethyl)-1H-Pyrrolo[3,4-b]pyridine;1H-Pyrrolo[3,4-b]pyridine, octahydro-6-(phenylmethyl)-;6-Benzyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;Octahydro-6-(benzyl)-1H-pyrrolo[3,4-b]pyridine;6-BENZYL-OCTAHYDRO-PYRROLO[3,4-B]PYRIDINE ISO 9001:2015 REACH | | CAS: | 128740-14-7 | | MF: | C14H20N2 | | MW: | 216.32 | | EINECS: | 929-459-3 | | Product Categories: | pharmacetical;Heterocycle-Pyridine series | | Mol File: | 128740-14-7.mol | ![6-BENZYL-OCTAHYDRO-PYRROLO[3,4-B]PYRIDINE Structure](CAS/GIF/128740-14-7.gif) |
| | 6-BENZYL-OCTAHYDRO-PYRROLO[3,4-B]PYRIDINE Chemical Properties |
| Boiling point | 322℃ | | density | 1.049 | | Fp | 131℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 10.99±0.20(Predicted) | | form | Oil | | color | Clear Light yellow to Light Brown | | InChI | InChI=1S/C14H20N2/c1-2-5-12(6-3-1)9-16-10-13-7-4-8-15-14(13)11-16/h1-3,5-6,13-15H,4,7-11H2 | | InChIKey | AFYZAHZKOFBVLE-UHFFFAOYSA-N | | SMILES | C12CN(CC3=CC=CC=C3)CC1CCCN2 |
| | 6-BENZYL-OCTAHYDRO-PYRROLO[3,4-B]PYRIDINE Usage And Synthesis |
| Uses | Octahydro-6-(phenylmethyl)-1H-Pyrrolo[3,4-b]pyridine is an intermediate in the synthesis of moxifoxacin (M745000), a fluorinated quinolone antibacterial. |
| | 6-BENZYL-OCTAHYDRO-PYRROLO[3,4-B]PYRIDINE Preparation Products And Raw materials |
|