- Brexpiprazole Impurity
-
- $0.00 / 10mg
-
2025-12-16
- CAS:1191900-58-9
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 100000
|
| | Brexpiprazole N-Oxide Basic information |
| Product Name: | Brexpiprazole N-Oxide | | Synonyms: | 2(1H)-Quinolinone, 7-[4-(4-benzo[b]thien-4-yl-1-oxido-1-piperazinyl)butoxy]-;Brexpiprazole-d8 N-Oxide;Brexpiprazole-imG;Brexpiprazole N1-Oxide;Brexpiprazole N-Oxide
7-[4-(4-Benzo[b]thien-4-yl-1-oxido-1-piperazinyl)butoxy]
-2(1H)-quinolinone;Brexpiprazole Dimer Impurity G;Bripiprazole Impurity 24;Bripiprazole Impurity | | CAS: | 1191900-58-9 | | MF: | C25H27N3O3S | | MW: | 449.57 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 1191900-58-9.mol |  |
| | Brexpiprazole N-Oxide Chemical Properties |
| solubility | Methanol (Very Slightly, Heated) | | form | Solid | | color | White | | Stability: | Not Stable in DMSO | | InChI | InChI=1S/C25H27N3O3S/c29-25-9-7-19-6-8-20(18-22(19)26-25)31-16-2-1-13-28(30)14-11-27(12-15-28)23-4-3-5-24-21(23)10-17-32-24/h3-10,17-18H,1-2,11-16H2,(H,26,29) | | InChIKey | OAVMANIAJDSQQC-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(OCCCC[N+]3([O-])CCN(C4=C5C=CSC5=CC=C4)CC3)=C2)C=CC1=O |
| | Brexpiprazole N-Oxide Usage And Synthesis |
| Uses | Brexpiprazole N-Oxide is an impurity and potential metabolite of Brexpiprazole (B677385), a drug candidate useful in treatment and prevention of mental disorders including CNS disorders. |
| | Brexpiprazole N-Oxide Preparation Products And Raw materials |
|