|
|
| | 4-Bromobenzyl bromide Basic information |
| | 4-Bromobenzyl bromide Chemical Properties |
| Melting point | 62-64 °C(lit.) | | Boiling point | 115-124 °C (12 mmHg) | | density | 1.8246 (rough estimate) | | refractive index | 1.6066 (estimate) | | Fp | 115-124°C/12mm | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | Coarse Crystalline Solid or Solid Melt | | color | White to tan | | Water Solubility | MAY DECOMPOSE | | Sensitive | Lachrymatory | | Merck | 14,1409 | | BRN | 606498 | | Henry's Law Constant | 3.6×10-2 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | InChI=1S/C7H6Br2/c8-5-6-1-3-7(9)4-2-6/h1-4H,5H2 | | InChIKey | YLRBJYMANQKEAW-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(CBr)C=C1 | | CAS DataBase Reference | 589-15-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1-bromo-4-(bromomethyl)- (589-15-1) |
| Hazard Codes | C | | Risk Statements | 34-42/43 | | Safety Statements | 22-26-36/37/39-45-25 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 19 | | Hazard Note | Corrosive/Lachrymatory | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29036990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Resp. Sens. 1
Skin Corr. 1B |
| | 4-Bromobenzyl bromide Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Identification of aromatic carboxylic acids. | | Uses | 4-Bromobenzyl bromide is used to prepare a 20-member aminomethyl-substituted biaryl library via sequential N-alkylation of various amines. | | Synthesis Reference(s) | Synthetic Communications, 11, p. 669, 1981 DOI: 10.1080/00397918108063642 | | Purification Methods | Crystallise the bromide from EtOH. [Beilstein 5 IV 836.] LACHRYMATORY. |
| | 4-Bromobenzyl bromide Preparation Products And Raw materials |
|