| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | (2,2'-bipyridine)Cu(SCF3) Basic information |
| Product Name: | (2,2'-bipyridine)Cu(SCF3) | | Synonyms: | TRIFLUOROMETHYLTHIOLATO(2,2-BIPYRIDINE)COPPER(I),97%;Trifluoromethylthiolato(2,2-bipyridine)copper(I), 97%;(2,2'-bipyridine)Cu(SCF3);ato(2,2-bipyridine)copper(I);[(trifluoromethyl)sulfanyl]copper;Copper, (2,2′-bipyridine-κN1,κN1′)(1,1,1-trifluoromethanethiolato-κS)-;Copper, (2,2 inverted exclamation marka-bipyridine-|EN1,|EN1 inverted exclamation marka)(1,1,1-trifluoromethanethiolato-|ES)-;(2,2'-Bipyridine)copper(I) Trifluoromethanethiolate | | CAS: | 1413732-47-4 | | MF: | C11H8CuF3N2S | | MW: | 320.8 | | EINECS: | | | Product Categories: | | | Mol File: | 1413732-47-4.mol |  |
| | (2,2'-bipyridine)Cu(SCF3) Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | crystal | | color | red | | Sensitive | air sensitive, moisture sensitive | | InChI | InChI=1S/C10H8N2.CHF3S.Cu/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2-1(3,4)5;/h1-8H;5H; | | InChIKey | FKZCXMUPZRYLGW-UHFFFAOYSA-N | | SMILES | [SH-]([Cu+]1N2=CC=CC=C2C2=CC=CC=N12)C(F)(F)F |
| | (2,2'-bipyridine)Cu(SCF3) Usage And Synthesis |
| Uses | Novel, air-stable copper reagent for trifluoromethylthiolation of aryl halides. |
| | (2,2'-bipyridine)Cu(SCF3) Preparation Products And Raw materials |
|