- PO14 (PPF)
-
- $0.00 / 1g
-
2025-12-22
- CAS:911397-27-8
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100kgs
|
| | Phosphine oxide, 1,1-(2,8-dibenzofurandiyl)bis[1,1-diphenyl- Basic information |
| Product Name: | Phosphine oxide, 1,1-(2,8-dibenzofurandiyl)bis[1,1-diphenyl- | | Synonyms: | Phosphine oxide, 1,1-(2,8-dibenzofurandiyl)bis[1,1-diphenyl-;2,8-Bis(diphenylphosphoryl)dibenzo[b,d]furan;2,8-Bis(diphenylphosphineoxide)dibenzofuran;PO14 (PPF);PO14;2,8-Bis(diphenylphosphoryl)dibenzofuran;Phosphine oxide, 2,8-dibenzofurandiylbis[diphenyl-;1,1-[2,8-dibenzofurandiyl]bis[1,1-diphenyl-Phosphine oxide | | CAS: | 911397-27-8 | | MF: | C36H26O3P2 | | MW: | 568.55 | | EINECS: | | | Product Categories: | | | Mol File: | 911397-27-8.mol |  |
| | Phosphine oxide, 1,1-(2,8-dibenzofurandiyl)bis[1,1-diphenyl- Chemical Properties |
| Melting point | 252 °C(dec.) | | Boiling point | 805.2±60.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | powder or crystals | | color | White to Light yellow | | InChIKey | AIAJGVRFXREWPK-UHFFFAOYSA-N | | SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)(C1=CC=C2OC3=CC=C(P(C4C=CC=CC=4)(C4C=CC=CC=4)=O)C=C3C2=C1)=O | | Absorption | λmax 300 nm in DCM |
| | Phosphine oxide, 1,1-(2,8-dibenzofurandiyl)bis[1,1-diphenyl- Usage And Synthesis |
| Description | PPF, dibenzo[b,d]furan-2,8-diylbis(diphenylphosphine Oxide), contains an electron donating dibenzo[b,d]furan core and two electron deficient diphenylphosphine oxide units. Due to its electron deficient nature, PPF and PPT can be used as electron transport layer materials, and in some cases, to form exciplex as emitting layer materials in TADF-OLED devices. | | General Description | A dibenzofuran-based host material for blue electrophosphorescence including thermally activated delayed fluorescence (TADF) OLEDs. |
| | Phosphine oxide, 1,1-(2,8-dibenzofurandiyl)bis[1,1-diphenyl- Preparation Products And Raw materials |
|