| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | tert-Butyl 3-formyl-4-hydroxybenzoate Basic information |
| Product Name: | tert-Butyl 3-formyl-4-hydroxybenzoate | | Synonyms: | tert-Butyl 3-formyl-4-hydroxybenzoate;2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate;Benzoic acid, 3-formyl-4-hydroxy-, 1,1-dimethylethyl ester;2,5-Furandione,3-chlorodihydro-,(5R)- | | CAS: | 1224157-88-3 | | MF: | C12H14O4 | | MW: | 222.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1224157-88-3.mol |  |
| | tert-Butyl 3-formyl-4-hydroxybenzoate Chemical Properties |
| Boiling point | 327.1±27.0 °C(Predicted) | | density | 1.188±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 6.49±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H14O4/c1-12(2,3)16-11(15)8-4-5-10(14)9(6-8)7-13/h4-7,14H,1-3H3 | | InChIKey | LBSSNJFKFJEHIA-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)C1=CC=C(O)C(C=O)=C1 |
| | tert-Butyl 3-formyl-4-hydroxybenzoate Usage And Synthesis |
| | tert-Butyl 3-formyl-4-hydroxybenzoate Preparation Products And Raw materials |
|