|
|
| Product Name: | ML311 | | Synonyms: | ML311;7-[(4-Ethyl-1-piperazinyl)[4-(trifluoromethyl)phenyl]methyl]-8-quinolinol;2-((4-ethylpiperazin-1-yl)(4-(trifluoromethyl)phenyl)methyl)naphthalen-1-ol;ML 311,Inhibitor,ML-311,Bcl-2 Family,ML311,inhibit;8-Quinolinol, 7-[(4-ethyl-1-piperazinyl)[4-(trifluoromethyl)phenyl]methyl]-;7-((4-Ethylpiperazin-1-yl)(4-(trifluoromethyl)phenyl)methyl)quinolin-8-ol;7-((4-Ethylpiperazin-1-yl)(4-(trifluoromethyl)phenyl)methyl)quinolin-8-ol , ML311;ML311, 10 mM in DMSO | | CAS: | 315698-17-0 | | MF: | C23H24F3N3O | | MW: | 415.45 | | EINECS: | | | Product Categories: | | | Mol File: | 315698-17-0.mol |  |
| | ML311 Chemical Properties |
| Melting point | >94*C (dec.) | | Boiling point | 515.7±45.0 °C(Predicted) | | density | 1.268±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.38±0.50(Predicted) | | form | Solid | | color | Yellow | | InChIKey | NGAPBLRRJSKIRT-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(cc1)C(N4CCN(CC4)CC)c2c(c3ncccc3cc2)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | ML311 Usage And Synthesis |
| Uses | 7-[(4-Ethyl-1-piperazinyl)[4-(trifluoromethyl)phenyl]methyl]-8-quinolinol is a selective inhibitor of the protein -protein interaction of Mcl-1 inhibitors and also a potential antitumor agents. Structure-guided design of a series of MCL-1 inhibitors with high affinity and selectivity. | | Biological Activity | Cell permeable: yes', 'Primary Target
Mcl-1', 'Reversible: yes | | IC 50 | Mcl-1; Bim | | storage | Store at -20°C |
| | ML311 Preparation Products And Raw materials |
|