|
|
| | 6-CHLORO-7-METHYLCHROMONE Basic information |
| Product Name: | 6-CHLORO-7-METHYLCHROMONE | | Synonyms: | 6-CHLORO-7-METHYL-4H-CHROMEN-4-ONE;6-CHLORO-7-METHYLCHROMONE;6-CHLORO-7-METHYLCHROMONE 99%;JRH-00605, 6-Chloro-7-methyl-4H-chromen-4-one, 97%;4H-1-Benzopyran-4-one, 6-chloro-7-Methyl-;6-chloro-7-methylchromen-4-one;6-Chloro-7-methylchromone >;6- chlor -7-methyl- chromone | | CAS: | 67029-84-9 | | MF: | C10H7ClO2 | | MW: | 194.61 | | EINECS: | | | Product Categories: | | | Mol File: | 67029-84-9.mol |  |
| | 6-CHLORO-7-METHYLCHROMONE Chemical Properties |
| Melting point | 171-173 °C (dec.)(lit.) | | Boiling point | 323.1±42.0 °C(Predicted) | | density | 1.339±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | color | White to Light yellow | | InChI | 1S/C10H7ClO2/c1-6-4-10-7(5-8(6)11)9(12)2-3-13-10/h2-5H,1H3 | | InChIKey | UQXYHMICNLSDMN-UHFFFAOYSA-N | | SMILES | O=C(C=CO1)C(C1=C2)=CC(Cl)=C2C | | CAS DataBase Reference | 67029-84-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-36-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 6-CHLORO-7-METHYLCHROMONE Usage And Synthesis |
| | 6-CHLORO-7-METHYLCHROMONE Preparation Products And Raw materials |
|