- BOC-L-NORLEUCINE
-
- $1.00 / 1KG
-
2019-07-06
- CAS:6404-28-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg,5kg,100kg
|
| | BOC-L-NORLEUCINE Basic information |
| Product Name: | BOC-L-NORLEUCINE | | Synonyms: | (S)-2-((tert-Butoxycarbonyl)aMino)hexanoic acid;N-[(1,1-Dimethylethoxy)carbonyl]-L-norleucine;BOC-L-Norleucine,98%;N-Boc-L-Norleucine (Dry wt.), May Cont. up to ca 10% Solvent;Norleucine, N-carboxy-, N-tert-butyl ester;(Tert-Butoxy)Carbonyl Nle-OH (Syrup);Boc-(S)-2-aminohexanoicacid;BOC-L-NORLEUCINE | | CAS: | 6404-28-0 | | MF: | C11H21NO4 | | MW: | 231.29 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 6404-28-0.mol |  |
| | BOC-L-NORLEUCINE Chemical Properties |
| Boiling point | 373.37°C (rough estimate) | | density | 1.1202 (rough estimate) | | refractive index | 1.4425 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 4.02±0.21(Predicted) | | form | Powder | | color | Colorless to light yellow | | Optical Rotation | [α]20/D 8±1°, c = 1% in methanol | | BRN | 3608376 | | Major Application | peptide synthesis | | InChI | 1S/C11H21NO4/c1-5-6-7-8(9(13)14)12-10(15)16-11(2,3)4/h8H,5-7H2,1-4H3,(H,12,15)(H,13,14)/t8-/m0/s1 | | InChIKey | ZIOCIQJXEKFHJO-QMMMGPOBSA-N | | SMILES | CCCC[C@H](NC(=O)OC(C)(C)C)C(O)=O | | CAS DataBase Reference | 6404-28-0(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29224985 | | Storage Class | 10 - Combustible liquids |
| | BOC-L-NORLEUCINE Usage And Synthesis |
| Uses | A boc protected amino acid derivative | | reaction suitability | reaction type: Boc solid-phase peptide synthesis | | Synthesis | The general procedure for the synthesis of N-BOC-L-norleucine from L-norleucine and di-tert-butyl dicarbonate was as follows: free L-norleucine (400 mg, 3.05 mmol) was dissolved in a solvent mixture of water and THF (8.8 mL:8.8 mL), NaHCO3 (768 mg, 9.15 mmol) was added and di-tert-butyl dicarbonate ( 800 mg, 3.66 mmol). The reaction mixture was stirred at 0 °C for 30 min, then gradually warmed to room temperature and continued to stir overnight. Upon completion of the reaction, water (10 mL) was added to dissolve any precipitate that may have formed. Unreacted di-tert-butyl dicarbonate was removed by three extractions with petroleum ether. N-BOC-L-norleucine in the aqueous phase was acidified to pH ≈ 3 with 1 M NaHSO4 solution and subsequently extracted three times with EtOAc. The organic layers were combined and dried with Na2SO4. The solvent was removed by concentration under reduced pressure to give the clear oily product N-BOC-L-norleucine (573 mg, 81% yield). The product was characterized by 1H NMR (400 MHz, DMSO-d6): δ 12.38 (bs, 1H, COOH), 7.02 (d, J=8.2 Hz, 1H, NH), 3.87-3.78 (m, 1H, CH), 1.69-1.47 (m, 2H, CH2), 1.37 (s, 9H, t-Bu), 1.32- 1.20 (m, 4H, CH2), 0.85 (t, J=7.0Hz, 3H, CH3). | | References | [1] Bioorganic and Medicinal Chemistry, 2015, vol. 23, # 21, p. 6891 - 6899 [2] Bioorganic and medicinal chemistry letters, 2004, vol. 14, # 1, p. 275 - 278 |
| | BOC-L-NORLEUCINE Preparation Products And Raw materials |
|