- Para-Carborane
-
- $100.00 / 1G
-
2018-10-09
- CAS:20644-12-6
- Min. Order: 1G
- Purity: 98.0%min
- Supply Ability: 20 tons
|
| | 1,12-DICARBADODECABORANE(12) Basic information |
| Product Name: | 1,12-DICARBADODECABORANE(12) | | Synonyms: | 1,12-Dicarba-closo-dodecaborane(12);1,12-Dicarbadodecaboran;p-Baren;1,12-DICARBADODECABORA;Para-Carborane;para-dicarbadodecaborane;p-Carbaboran(12);p-Carboran | | CAS: | 20644-12-6 | | MF: | C2H12B10 | | MW: | 144.23 | | EINECS: | | | Product Categories: | | | Mol File: | 20644-12-6.mol |  |
| | 1,12-DICARBADODECABORANE(12) Chemical Properties |
| Melting point | 200-203 °C(lit.) | | InChI | InChI=1S/C2H12B10/c3-1-4-5-2(3)7-9-11-12-10-8-6-1/h1-12H | | InChIKey | JKYPVMIWOAAVGH-UHFFFAOYSA-N | | SMILES | C12BBBBBBBC(BB1)B2 |
| | 1,12-DICARBADODECABORANE(12) Usage And Synthesis |
| Uses |
1,12-dicarbadodecaborane(12) is used in preparation of covalent organic framework material using Carborane as starting material.
| | Application |
1,12-dicarbadodecaborane(12) is usually used as an addictive in plastics and rubbers.
|
| | 1,12-DICARBADODECABORANE(12) Preparation Products And Raw materials |
|