| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:3,3'-Diethylthiacyanine iodide, dye content ^=97%
CAS:2197-01-5
Package:250Mg Remarks:H55713
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:3,3 -Diethylthiacyanine iodide, dye content ^=97%
CAS:2197-01-5
Purity:NULL Package:5g;1g Remarks:NULL
|
|
| | 3,3'-DIETHYLTHIACYANINE IODIDE Basic information |
| Product Name: | 3,3'-DIETHYLTHIACYANINE IODIDE | | Synonyms: | 3,3'-DIETHYLTHIACYANINE IODIDE;1-ETHYL-2-(1-ETHYL-1,3-BENZTHIAZOLIN-2-YLIDEN-METHYL)-1,3-BENZTHIAZOLIUM-IODIDE;3,3`-Doethylthiacyanine iodide;3,3'-Diethylthiacyanine iodide, Dye content &bsim:97%;3-ethyl-2-[(3-ethyl-2(3h)-benzothiazolylidene)methyl]-benzothiazoliuiodide;3-ethyl-2-[(3-ethyl-3H-benzothiazol-2-ylidene)methyl]benzothiazolium iodide;2-(2,3-Dihydro-3-ethylbenzothiazole-2-ylidenemethyl)-3-ethylbenzothiazole-3-ium·iodide;2-(3-Ethyl-2,3-dihydrobenzothiazole-2-ylidenemethyl)-3-ethylbenzothiazole-3-ium·iodide | | CAS: | 2197-01-5 | | MF: | C19H19IN2S2 | | MW: | 466.4 | | EINECS: | 218-593-1 | | Product Categories: | | | Mol File: | 2197-01-5.mol |  |
| | 3,3'-DIETHYLTHIACYANINE IODIDE Chemical Properties |
| Melting point | 262 °C (decomp) | | storage temp. | room temp | | form | Powder | | color | Yellow to dark green | | λmax | 424 nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C19H19N2S2.HI/c1-3-20-14-9-5-7-11-16(14)22-18(20)13-19-21(4-2)15-10-6-8-12-17(15)23-19;/h5-13H,3-4H2,1-2H3;1H/q+1;/p-1 | | InChIKey | XWUVSDMFUQTKQC-UHFFFAOYSA-M | | SMILES | [I-].CCN1\C(Sc2ccccc12)=C\c3sc4ccccc4[n+]3CC | | EPA Substance Registry System | Benzothiazolium, 3-ethyl-2-[(3-ethyl-2(3H)-benzothiazolylidene)methyl]-, iodide (2197-01-5) |
| Hazard Codes | T | | Risk Statements | 23/24/25-36/37/38 | | Safety Statements | 26-36/37/39-45 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,3'-DIETHYLTHIACYANINE IODIDE Usage And Synthesis |
| Uses | 3,3μ-Diethylthiacyanine iodide has been used to investigate the kinetics of fluorescence staining in bacteria (two Gram-negative and two Gram-positive species). |
| | 3,3'-DIETHYLTHIACYANINE IODIDE Preparation Products And Raw materials |
|