|
|
| | L-Asparagine-15N2, alpha-N-Fmoc derivative Basic information |
| Product Name: | L-Asparagine-15N2, alpha-N-Fmoc derivative | | Synonyms: | L-Asparagine-15N2, α-N-Fmoc derivative;N-(9-Fluorenylmethoxycarbonyl)-L-asparagine-15N2;"L-Asparagine-15N2, N-Fmoc";L-Asparagine-15N2, N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-;Fmoc-Asn-OH-15N2;L-Asparagine-15N2, alpha-N-Fmoc derivative | | CAS: | 287484-42-8 | | MF: | C19H18N2O5 | | MW: | 356.34 | | EINECS: | | | Product Categories: | | | Mol File: | 287484-42-8.mol |  |
| | L-Asparagine-15N2, alpha-N-Fmoc derivative Chemical Properties |
| Melting point | 190 °C(lit.) | | storage temp. | 2-8°C | | form | solid | | Optical Rotation | [α]20/D -13°, c =1 in DMF | | Major Application | peptide synthesis | | InChIKey | YUGBZNJSGOBFOV-DXEDVVLISA-N | | SMILES | [15NH2]C(=O)C[C@H]([15NH]C(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Asparagine-15N2, alpha-N-Fmoc derivative Usage And Synthesis |
| | L-Asparagine-15N2, alpha-N-Fmoc derivative Preparation Products And Raw materials |
|