|
|
| | 2-Chloropyrimidine-5-carboxylic acid Basic information |
| | 2-Chloropyrimidine-5-carboxylic acid Chemical Properties |
| Melting point | 126-131 °C | | Boiling point | 411.4±18.0 °C(Predicted) | | density | 1.579±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder or Crystalline Powder | | pka | 2.51±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C5H3ClN2O2/c6-5-7-1-3(2-8-5)4(9)10/h1-2H,(H,9,10) | | InChIKey | DUCXUPKLVVSJKA-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(O)=O)C=N1 |
| WGK Germany | WGK 3 | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Chloropyrimidine-5-carboxylic acid Usage And Synthesis |
| Uses | 2-Chloropyrimidine-5-carboxylic acid is carboxylic acid organic compounds, mainly used as pharmaceutical intermediates. | | Uses | 2-Chloropyrimidine-5-carboxylic Acid is a compound involved in the synthesis of novel (6-aminopyridin-3-yl)(4-(pyridin-2-yl)piperazin-1-yl) methanone derivatives as TRPV4 antagonists for the treatment of pain. |
| | 2-Chloropyrimidine-5-carboxylic acid Preparation Products And Raw materials |
|