|
|
| | Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate Basic information |
| Product Name: | Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate | | Synonyms: | DIMETHYL 3-(3-CHLOROPHENOXY)-2-OXOPROPYLPHOSPHONATE;Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate, 98 %;3-(m-Chlorophenoxy)-2-oxopropylphosphonic acid dimethyl ester;[2-Oxo-3-(3-chloro-phenoxy)-propyl]-phosphonic;Phosphonic acid, P-[3-(3-chlorophenoxy)-2-oxopropyl]-,dimethyl ester;Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate (N-6);DIMETHYL[3-(3-CHLOROPHENOXY)-2-OXOPROP-1-YL]PHOSPHONATE;Phosphonic acid, [3-(3-chlorophenoxy)-2-oxopropyl]-, dimethyl ester | | CAS: | 40665-94-9 | | MF: | C11H14ClO5P | | MW: | 292.65 | | EINECS: | | | Product Categories: | API | | Mol File: | 40665-94-9.mol |  |
| | Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate Chemical Properties |
| Melting point | 77-78 °C | | Boiling point | 400.1±30.0 °C(Predicted) | | density | 1.298±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H14ClO5P/c1-15-18(14,16-2)8-10(13)7-17-11-5-3-4-9(12)6-11/h3-6H,7-8H2,1-2H3 | | InChIKey | ZNPUZMPUXAFKQZ-UHFFFAOYSA-N | | SMILES | P(CC(=O)COC1=CC=CC(Cl)=C1)(=O)(OC)OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate Usage And Synthesis |
| Uses | Dimethyl 3-(3-Chlorophenoxy)-2-oxopropylphosphonate is an intermediate used in the synthesis of (+)-cloprostenol and α-pentanorbenzo analogs of prostaglandins. |
| | Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate Preparation Products And Raw materials |
|