- 2-NAPHTHYL TRIFLATE
-
- $1.00 / 1kg
-
2019-07-06
- CAS:3857-83-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| | 2-NAPHTHYL TRIFLATE Basic information |
| Product Name: | 2-NAPHTHYL TRIFLATE | | Synonyms: | Methanesulfonic acid,1,1,1-trifluoro-, 2-naphthalenyl ester;2-NAPHTHYL TRIFLATE;2-NAPHTHYL TRIFLUOROMETHANESULFONATE;2-(Trifluoromethylsulfonyloxy)naphthalene;2-Naphthol trifluoromethanesulfonate;Trifluoromethanesulfonic acid 2-naphthalenyl ester;Trifluoromethanesulfonic acid 2-naphtyl ester;Trifluoromethanesulfonic acid naphthalene-2-yl ester | | CAS: | 3857-83-8 | | MF: | C11H7F3O3S | | MW: | 276.23 | | EINECS: | | | Product Categories: | | | Mol File: | 3857-83-8.mol |  |
| | 2-NAPHTHYL TRIFLATE Chemical Properties |
| Melting point | 30-32 °C(lit.) | | Boiling point | 87°C/0.2mmHg(lit.) | | density | 1.493±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | color | White to orange | | InChI | InChI=1S/C11H7F3O3S/c12-11(13,14)18(15,16)17-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H | | InChIKey | MDWRQYBWVTXIIJ-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)S(OC1=CC=C2C(=C1)C=CC=C2)(=O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 22-26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2-NAPHTHYL TRIFLATE Usage And Synthesis |
| Uses | 2-Naphthyl trifluoromethanesulfonate (2-naphthyl triflate) may be used as an arylating agent in the arylation of 1-(methoxycarbonyl)-2,5-dihydropyrrole by Heck reaction. It may be used as a substrate for coupling with Reformatsky reagent BrZnCH(CH3)(COOtC4H9) in the presence of “reduced” dichlorobis(1,1-diphenylphosphino)ferrocene catalyst. | | General Description | 2-Naphthyl trifluoromethanesulfonate (2-naphthyl triflate) is an aryl triflate. Its ruthenium-catalyzed conversion to 2-bromonaphthalene has been reported. |
| | 2-NAPHTHYL TRIFLATE Preparation Products And Raw materials |
|