- Boc-L-Val-OL
-
- $0.00/ kg
-
2026-03-26
- CAS:79069-14-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- N-Boc-L-Valinol
-
- $200.00 / 1KG
-
2019-07-06
- CAS:79069-14-0
- Min. Order: 2KG
- Purity: 99%
- Supply Ability: 20kg
|
| | N-Boc-L-Valinol Basic information |
| | N-Boc-L-Valinol Chemical Properties |
| alpha | -23 º (c=1 in chloroform) | | Boiling point | 208 °C(lit.) | | density | 0.995 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.449(lit.) | | Fp | 185 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 12.02±0.46(Predicted) | | form | Powder | | Appearance | Colorless to light yellow Oil | | Optical Rotation | [α]23/D 23°, c = 1 in chloroform | | BRN | 4663728 | | Major Application | peptide synthesis | | InChI | 1S/C10H21NO3/c1-7(2)8(6-12)11-9(13)14-10(3,4)5/h7-8,12H,6H2,1-5H3,(H,11,13)/t8-/m1/s1 | | InChIKey | OOQRRYDVICNJGC-MRVPVSSYSA-N | | SMILES | CC(C)[C@@H](CO)NC(=O)OC(C)(C)C | | CAS DataBase Reference | 79069-14-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 10 - Combustible liquids |
| | N-Boc-L-Valinol Usage And Synthesis |
| Chemical Properties | Clear colorless to yellow liquid | | Uses | Starting material for the synthesis of enantiopure homo-β-amino acids. Used in the efficient synthesis of enantiopure tetrahydroisoquinolines. Intermediate in the one-pot conversion of amino acid carbamates to N-derivatized 2-oxazolidinones. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Boc-L-Valinol Preparation Products And Raw materials |
|