|
|
| | 4-Bromoisophthalic acid Basic information |
| | 4-Bromoisophthalic acid Chemical Properties |
| Melting point | 297-299 °C(lit.) | | Boiling point | 430.6±40.0 °C(Predicted) | | density | 1.8281 (rough estimate) | | refractive index | 1.4490 (estimate) | | storage temp. | Store at room temperature | | solubility | soluble in Methanol | | form | Crystalline Powder and Chunks | | pka | 2.48±0.10(Predicted) | | color | White to off-white | | BRN | 1959392 | | InChI | 1S/C8H5BrO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) | | InChIKey | MSQIEZXCNYUWHN-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(Br)c(c1)C(O)=O | | CAS DataBase Reference | 6939-93-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-37 | | WGK Germany | 3 | | HS Code | 29173990 | | Storage Class | 13 - Non Combustible Solids |
| | 4-Bromoisophthalic acid Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder and chunks | | Uses | 4-Bromoisophthalic Acid is an inhibitor of glutamate decarboxylase. | | Synthesis | A mixture of 4-bromo-m-xylene (25.3 g, 137 mmol), KMnO4 (100 g, 633 mmol) and water (1.5 L) was heated at reflux for 16 hours.
The mixture was cooled to room temperature and diafiltered. The filtrate was extracted by adding 6 M HCl aqueous solution (100 mL)
The filtrate was acidified and the white precipitate formed was separated by diafiltration and air dried to give 18.2 g of 4-bromo-1,3-benzenedicarboxylic acid, 54%. mp 286-290 C (lit. 26 ).
mp = 287 C). |
| | 4-Bromoisophthalic acid Preparation Products And Raw materials |
|