|
|
| | Methyl 3-(4-bromomethyl)cinnamate Basic information |
| Product Name: | Methyl 3-(4-bromomethyl)cinnamate | | Synonyms: | Methyl 3-(4-(broMoMethyl)phenyl)acrylate;Methyl 3-(4-bromomethyl)cinnamate
4-Bromomethylcinnamic acid methyl ester;Methyl 4-bromomethylcinnamate, >=98%;4-bromomethyl cinnamate;(E)-methyl 3-(4-(bromomethyl)phenyl)acrylate;METHYL-P-BROMOMETHYL-CINNAMATE;METHYL-4-BROMOMETHYL-CINNAMATE;Methyl 3-(4-bromomethyl)cinnamate | | CAS: | 946-99-6 | | MF: | C11H11BrO2 | | MW: | 255.11 | | EINECS: | | | Product Categories: | Cinnamic acid;Aromatics;Inhibitors | | Mol File: | 946-99-6.mol |  |
| | Methyl 3-(4-bromomethyl)cinnamate Chemical Properties |
| Melting point | 62-63 °C | | Boiling point | 333.9±22.0 °C(Predicted) | | density | 1.418±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform, DMSO, Ethyl Acetate, Methanol | | form | Solid | | color | Pale Yellow | | InChI | InChI=1S/C11H11BrO2/c1-14-11(13)7-6-9-2-4-10(8-12)5-3-9/h2-7H,8H2,1H3 | | InChIKey | ZSRCGGBALFGALF-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C=CC1=CC=C(CBr)C=C1 | | CAS DataBase Reference | 946-99-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | HS Code | 2916399090 |
| | Methyl 3-(4-bromomethyl)cinnamate Usage And Synthesis |
| Uses | Methyl 3-(4-bromomethyl)cinnamate is used in the synthesis of p-, m-, and ο-bis-(2-chloroethyl)aminomethylcinnamic acid hydrochloride and their esters as inhibitors. | | Uses | Used in the synthesis of p-, m-, and ο-bis-(2-chloroethyl)aminomethylcinnamic acid hydrochloride and their esters as inhibitors. | | Synthesis | Methyl 3-(4-bromomethyl)cinnamate can be obtained by esterification of cinnamic acid with methyl bromide. |
| | Methyl 3-(4-bromomethyl)cinnamate Preparation Products And Raw materials |
|