|
|
| | 4,5-DIMETHYL-2-NITROANILINE Basic information |
| Product Name: | 4,5-DIMETHYL-2-NITROANILINE | | Synonyms: | TIMTEC-BB SBB003892;2-NITRO-4,5-DIMETHYL ANILINE;4,5-dimethyl-2-nitro-benzenamin;6-NITRO-3,4-XYLIDINE;4,5-DIMETHYL-2-NITROANILINE;2-nitro-4,5-xylidine;4,5-DIMETHYL-2-NITROANILINE / 6-NITRO-3,4-XYLIDINE;2-Amino-4,5-dimethylnitrobenzene, 6-Nitro-3,4-xylidine, 4-Amino-5-nitro-o-xylene | | CAS: | 6972-71-0 | | MF: | C8H10N2O2 | | MW: | 166.18 | | EINECS: | 230-211-5 | | Product Categories: | Amines;C8;Nitrogen Compounds | | Mol File: | 6972-71-0.mol |  |
| | 4,5-DIMETHYL-2-NITROANILINE Chemical Properties |
| Melting point | 139-141 °C(lit.) | | Boiling point | 314.38°C (rough estimate) | | density | 1.2275 (estimate) | | refractive index | 1.6273 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 0.71±0.25(Predicted) | | form | powder | | Appearance | Light brown to reddish brown Solid | | BRN | 2209637 | | InChI | 1S/C8H10N2O2/c1-5-3-7(9)8(10(11)12)4-6(5)2/h3-4H,9H2,1-2H3 | | InChIKey | PINGKGKKUSYUAW-UHFFFAOYSA-N | | SMILES | Cc1cc(N)c(cc1C)[N+]([O-])=O | | CAS DataBase Reference | 6972-71-0(CAS DataBase Reference) | | EPA Substance Registry System | 4,5-Dimethyl-2-nitroaniline (6972-71-0) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4,5-DIMETHYL-2-NITROANILINE Usage And Synthesis |
| Chemical Properties | brown crystalline powder | | Uses | Used to synthesize metal complexes. |
| | 4,5-DIMETHYL-2-NITROANILINE Preparation Products And Raw materials |
|