|
|
| | 1,4-DIIODOOCTAFLUOROBUTANE Basic information |
| Product Name: | 1,4-DIIODOOCTAFLUOROBUTANE | | Synonyms: | 1,4-Diiodooctafluo;1,4-Diiodoperfluorobutane 98%;1,4-Diiodooctafluorobutane, 97%, stab. with copper;1,4-Diiodoperfluorobutane, 1,4-Diiodo-1,1,2,2,3,3,4,4-octafluorobutane;Octafluorotetramethylene diiodide;1,4-Diiodooctafluorobutane, stabilized with copper;1,4-DIIODOPERFLUOROBUTANE;1,4-DIIODOOCTAFLUOROBUTANE | | CAS: | 375-50-8 | | MF: | C4F8I2 | | MW: | 453.84 | | EINECS: | 206-788-4 | | Product Categories: | Synthetic Organic Chemistry;Alkyl;Halogenated Hydrocarbons;Organic Building Blocks;Fluorous Chemistry;Fluorous Compounds | | Mol File: | 375-50-8.mol |  |
| | 1,4-DIIODOOCTAFLUOROBUTANE Chemical Properties |
| Melting point | −9 °C(lit.) | | Boiling point | 150 °C(lit.) | | density | 2.474 g/mL at 25 °C(lit.) | | vapor pressure | 16hPa at 25℃ | | refractive index | n20/D 1.429(lit.) | | Fp | 85°C/100mm | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Hexane (Slightly) | | form | Liquid | | color | Clear colorless to light yellow or pink | | Water Solubility | 9.3mg/L at 20℃ | | Sensitive | Light Sensitive | | BRN | 1777548 | | Stability: | Stable, but light sensitive. Incompatible with active metals, strong oxidants. | | InChI | 1S/C4F8I2/c5-1(6,3(9,10)13)2(7,8)4(11,12)14 | | InChIKey | JILAKKYYZPDQBE-UHFFFAOYSA-N | | SMILES | FC(F)(I)C(F)(F)C(F)(F)C(F)(F)I | | LogP | 3.8 | | CAS DataBase Reference | 375-50-8(CAS DataBase Reference) | | NIST Chemistry Reference | Butane, 1,1,2,2,3,3,4,4-octafluoro-1,4-diiodo-(375-50-8) | | EPA Substance Registry System | Perfluoro-1,4-diiodobutane (375-50-8) |
| Hazard Codes | T | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | TOXIC | | HS Code | 29034980 | | Storage Class | 10 - Combustible liquids |
| | 1,4-DIIODOOCTAFLUOROBUTANE Usage And Synthesis |
| Chemical Properties | liquid | | Uses | 1,4-Diiodooctafluorobutane is a chain transfer agent, which is used in method for producing fluoropolymer for perfluoroelastomer. | | General Description | Octafluoro-1,4-diiodobutane (ofib, C4F8I2) is also referred to as 1,1,2,2,3,3,4,4-octafluoro-1,4-diiodobutane. It acts as a halogen bond donor compound and its cocrystallization with methyldiphenylphosphine oxide (mdppo) has been investigated. In combination with a calixcrown compound ofib forms a ′binary host′ system, which is employed for the isolation of cesium iodide from aqueous to fluorous phase. |
| | 1,4-DIIODOOCTAFLUOROBUTANE Preparation Products And Raw materials |
|