BCI-121 manufacturers
- BCI-121
-
- $60.00 / 5mg
-
2026-04-21
- CAS:432529-82-3
- Min. Order:
- Purity: 99.67%
- Supply Ability: 10g
|
| | BCI-121 Basic information |
| Product Name: | BCI-121 | | Synonyms: | BCI-121;BCI 121;BCI121;BCI-121;1-{2-[(4-bromophenyl)amino]-2-oxoethyl}piperidine-4-carboxamide;1-Piperidineacetamide, 4-(aminocarbonyl)-N-(4-bromophenyl)-;BCL 121;inhibit,BCI 121,Histone Methyltransferase,Inhibitor,BCI-121,BCI121;BCI-121, 10 mM in DMSO | | CAS: | 432529-82-3 | | MF: | C14H18BrN3O2 | | MW: | 340.22 | | EINECS: | | | Product Categories: | | | Mol File: | 432529-82-3.mol |  |
| | BCI-121 Chemical Properties |
| Boiling point | 576.1±50.0 °C(Predicted) | | density | 1.474±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF:30.0(Max Conc. mg/mL);88.18(Max Conc. mM)
DMSO:66.0(Max Conc. mg/mL);193.99(Max Conc. mM)
DMSO:PBS (pH 7.2) (1:2):0.33(Max Conc. mg/mL);0.97(Max Conc. mM)
Ethanol:39.0(Max Conc. mg/mL);114.63(Max Conc. mM) | | form | powder | | pka | 13.82±0.70(Predicted) | | color | white to beige | | InChI | 1S/C14H18BrN3O2/c15-11-1-3-12(4-2-11)17-13(19)9-18-7-5-10(6-8-18)14(16)20/h1-4,10H,5-9H2,(H2,16,20)(H,17,19) | | InChIKey | KSUYPIXCRPCPGF-UHFFFAOYSA-N | | SMILES | Brc1ccc(cc1)NC(=O)CN2CCC(CC2)C(=O)N |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | BCI-121 Usage And Synthesis |
| Uses | BCI-121 is a SMYD3 inhibitor that impairs the proliferation of cancer cell. | | Biochem/physiol Actions | BCI-121 is a substrate-competitive SMYD3 inhibitor that reduces nuclear histone H3 lys4 di- and tri-methylation level (by 50%/H3K4me2 and 40%H3K4me3 in HT29 cells; 100 μM BCI-121 for 48 h), downregulates known SMYD3 target genes transcription, and selectively affects SMYD3-dependent proliferation of cancer cultures (46%/HT29 and 54%/HCT116 proliferation reduction; 100 μM BCI-121 for 72 h) with little antiproliferation efficacy toward low SMYD3-expressing cancer cells. BCI-121 targets SMYD3 via direct affinity interaction (kon 357.7/M/s; koff 4.23×10-3/s; KD=koff/kon = 11.8 μM) and effectively competes against histone for SMYD3 binding (%inhibition/[histone H4 peptide]:[BCI-121] ratio = 36.5%/1:1 and 51.0%/1:2.5). | | IC 50 | SMYD3 | | References | [1] Peserico A, et al. A SMYD3 Small-Molecule Inhibitor Impairing Cancer Cell Growth. J Cell Physiol. 2015 Oct;230(10):2447-2460. DOI:10.1002/jcp.24975 |
| | BCI-121 Preparation Products And Raw materials |
|