| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | tert-butyl 7-formyl-2-azaspiro[3.5]nonane-2-carboxylate Basic information |
| | tert-butyl 7-formyl-2-azaspiro[3.5]nonane-2-carboxylate Chemical Properties |
| Boiling point | 353.1±42.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | storage temp. | -20°C, stored under nitrogen | | pka | -1.07±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H23NO3/c1-13(2,3)18-12(17)15-9-14(10-15)6-4-11(8-16)5-7-14/h8,11H,4-7,9-10H2,1-3H3 | | InChIKey | DENTZXANSHPNOQ-UHFFFAOYSA-N | | SMILES | C1C2(CCC(C=O)CC2)CN1C(OC(C)(C)C)=O |
| | tert-butyl 7-formyl-2-azaspiro[3.5]nonane-2-carboxylate Usage And Synthesis |
| | tert-butyl 7-formyl-2-azaspiro[3.5]nonane-2-carboxylate Preparation Products And Raw materials |
|