| Company Name: |
Keminntek Laboratories
|
| Tel: |
+91-040-29704569 +91-9515661451 |
| Email: |
info@keminnteklabs.com |
| Products Intro: |
Product Name:(-)-Trans-Limonene Oxide
CAS:42477-94-1
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-66061636 19370895928 |
| Email: |
qqyang@aikonchem.com |
| Products Intro: |
Product Name:(1R,4S,6S)-1-Methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane
CAS:42477-94-1
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
TCI (Shanghai) Chemical Trading Co., Ltd.
|
| Tel: |
021-61109150 |
| Email: |
sales@tcisct.com |
| Products Intro: |
Product Name:cis-(S)-4-Isopropenyl-1-methylcyclohexene1,2-epoxide
CAS:42477-94-1
Purity:根据客户需求提供 Package:1KG;10KG;100KG;
|
|
| | cis-(S)-4-Isopropenyl-1-methylcyclohexene 1,2-epoxide Basic information |
| | cis-(S)-4-Isopropenyl-1-methylcyclohexene 1,2-epoxide Chemical Properties |
| Boiling point | 198.1±9.0 °C(Predicted) | | density | 0.972±0.06 g/cm3(Predicted) | | refractive index | n/D 1.467 | | storage temp. | 2-8°C | | form | liquid | | InChI | 1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9-,10+/m0/s1 | | InChIKey | CCEFMUBVSUDRLG-LPEHRKFASA-N | | SMILES | O1[C@]2([C@@H]1C[C@H](CC2)C(=C)C)C |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | cis-(S)-4-Isopropenyl-1-methylcyclohexene 1,2-epoxide Usage And Synthesis |
| Uses | trans-(-)-Limonene oxide is a valuable chiral terpene oxide building block.Used in the synthesis of Phosphorus Incorporation (PI) reagents, as a biologically sourced component of polycarbonate polymers, and as a building block for synthetic applications requiring a reactive epoxide or alkene. |
| | cis-(S)-4-Isopropenyl-1-methylcyclohexene 1,2-epoxide Preparation Products And Raw materials |
|