|
|
| | ZET1 Basic information | | Uses |
| Product Name: | ZET1 | | Synonyms: | ZET1;2-Benzothiazolesulfinic acid, sodium salt (1:1);Benzo[d]thiazole-2-sulfinic acid, sodium salt | | CAS: | 61073-62-9 | | MF: | C7H6NNaO2S2 | | MW: | 223.24 | | EINECS: | | | Product Categories: | | | Mol File: | 61073-62-9.mol |  |
| InChI | InChI=1S/C7H5NO2S2.Na.H/c9-12(10)7-8-5-3-1-2-4-6(5)11-7;;/h1-4H,(H,9,10);; | | InChIKey | WWFVQDDNLNGBAB-UHFFFAOYSA-N | | SMILES | S(C1SC2C=CC=CC=2N=1)(O)=O.[NaH] |
| Uses | Benzo[D]thiazole-2-sulfinate sodium thiazole derivatives are used in pharmaceutical synthesis and experimental research. |
| | ZET1 Preparation Products And Raw materials |
|