E3 ligase Ligand-Linker Conjugates 6 manufacturers
|
| | E3 ligase Ligand-Linker Conjugates 6 Basic information |
| Product Name: | E3 ligase Ligand-Linker Conjugates 6 | | Synonyms: | E3 ligase Ligand-Linker Conjugates 6;(S,R,S)-AHPC-PEG2-NH2 hydrochloride;VH032-PEG2-NH2 hydrochloride;VHL Ligand-Linker Conjugates 3 hydrochloride;(S,R,S)-AHPC-PEG2-NH2 hydrochloride >=95%;(S,R,S)-AHPC-PEG2-NH2 hydrochloride E3 ligase Ligand-Linker Conjugates 6);(2S,4R)-1-((S)-2-(2-(2-(2-aminoethoxy)ethoxy)acetamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide hydrochloride;S)-AHPC-PEG2-NH2 hydrochloride | | CAS: | 2097973-72-1 | | MF: | C28H42ClN5O6S | | MW: | 612.18 | | EINECS: | | | Product Categories: | | | Mol File: | 2097973-72-1.mol |  |
| | E3 ligase Ligand-Linker Conjugates 6 Chemical Properties |
| storage temp. | 2-8°C | | form | Solid | | color | White to yellow | | InChIKey | SYAOHFUUVWFWJH-ZBXLSASTSA-N | | SMILES | O=C(NCC1=CC=C(C2=C(C)N=CS2)C=C1)[C@H](C[C@@H](O)C3)N3C([C@H](C(C)(C)C)NC(COCCOCCN)=O)=O.Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| | E3 ligase Ligand-Linker Conjugates 6 Usage And Synthesis |
| Uses | Protein degrader builiding block (S,R,S)-AHPC-PEG2-NH2 (HCl salt) enables the synthesis of molecules for targeted protein degradation and PROTAC (proteolysis-targeting chimeras) technology. This conjugate contains a von Hippel-Lindau (VHL)-recruiting ligand and a PEGylated crosslinker with pendant amine for reactivity with a carboxyl group on the target ligand. Because even slight alterations in ligands and crosslinkers can affect ternary complex formation between the target, E3 ligase, and PROTAC, many analogs are prepared to screen for optimal target degradation. When used with other protein degrader building blocks with a pendant amine, parallel synthesis can be used to more quickly generate PROTAC libraries that feature variation in crosslinker length, composition, and E3 ligase ligand. | | reaction suitability | reactivity: carboxyl reactive
reagent type: ligand-linker conjugate | | IC 50 | VHL |
| | E3 ligase Ligand-Linker Conjugates 6 Preparation Products And Raw materials |
|