|
|
| | 5,7-Di-chloro-1,2,3,4-tetrahydroisoquinoline HCl Basic information |
| Product Name: | 5,7-Di-chloro-1,2,3,4-tetrahydroisoquinoline HCl | | Synonyms: | 5,7-DICHLORO-1,2,3,4-TETRAHYDRO-ISOQUINOLINE HYDROCHLORIDE;Isoquinoline, 5,7-dichloro-1,2,3,4-tetrahydro-, hydrochloride;Isoquinoline, 5,7-dichloro-1,2,3,4-tetrahydro-, hydrochloride (1:1);5,7-DI-CHLORO-1,2,3,4-TETRAHYDROISOQUINOLINE HCL ISO 9001：2015 REACH;Ifitegrast intermediate;Lifitegrast Impurity 36;Lifitegrast Impurity 28;Lifitegrast Impurity 12 HCl | | CAS: | 73075-47-5 | | MF: | C9H10Cl3N | | MW: | 238.54 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 5,7-Di-chloro-1,2,3,4-tetrahydroisoquinoline HCl Chemical Properties |
| Melting point | 300 °C(Solv: methanol (67-56-1)) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H9Cl2N.ClH/c10-7-3-6-5-12-2-1-8(6)9(11)4-7;/h3-4,12H,1-2,5H2;1H | | InChIKey | OQLXYGUEFSFZIX-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC(Cl)=CC2CNCCC=21.Cl |
| | 5,7-Di-chloro-1,2,3,4-tetrahydroisoquinoline HCl Usage And Synthesis |
| | 5,7-Di-chloro-1,2,3,4-tetrahydroisoquinoline HCl Preparation Products And Raw materials |
|