- Fmoc-D-Phe(2-F)-OH
-
- $2.20 / 100kg
-
2025-10-13
- CAS:198545-46-9
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
- FMOC-D-2-Fluorophe
-
- $0.00 / 1KG
-
2025-04-04
- CAS:198545-46-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- FMOC-D-2-Fluorophe
-
- $20.00 / 1KG
-
2019-07-06
- CAS:198545-46-9
- Min. Order: 10KG
- Purity: 99%
- Supply Ability: 100kg
|
| | FMOC-D-2-Fluorophe Basic information |
| | FMOC-D-2-Fluorophe Chemical Properties |
| Melting point | 145.3 °C | | alpha | 44 º (c=1,DMF) | | Boiling point | 620.3±55.0 °C(Predicted) | | density | 1.2642 (estimate) | | storage temp. | 2-8°C | | pka | 3.76±0.11(Predicted) | | form | Solid | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C24H20FNO4/c25-21-12-6-1-7-15(21)13-22(23(27)28)26-24(29)30-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h1-12,20,22H,13-14H2,(H,26,29)(H,27,28)/t22-/m1/s1 | | InChIKey | ARHOAMSIDCQWEW-JOCHJYFZSA-N | | SMILES | OC(=O)[C@@H](Cc1ccccc1F)NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 198545-46-9(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Harmful | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | FMOC-D-2-Fluorophe Usage And Synthesis |
| Chemical Properties | off-white to beige crystalline powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-2-Fluorophe Preparation Products And Raw materials |
|