- Ethyl 2-sulfamoylbenzoate
-
- $0.00 / 1KG
-
2025-12-12
- CAS:59777-72-9
- Min. Order: 1KG
- Purity: 99% HPLC
- Supply Ability: 1KG 100KG 1MT
|
| | Ethyl 2-sulfamoylbenzoate Basic information |
| Product Name: | Ethyl 2-sulfamoylbenzoate | | Synonyms: | Benzoic acid, 2-(aminosulfonyl)-, ethyl ester;2-SULFONAMIDOBENZOIC ACID ETHYL ESTER;2-SULFAMOYLBENZOIC ACID ETHYL ESTER;2-Ethylcarbonylbenzene sulfonamide;2-CARBOETHOXYBENZENE SULFONAMIDE;2-(AMINOSULFONYL)BENZOIC ACID ETHYL ESTER;ETHYL 2-SULFAMOYLBENZOATE;ETHYL 2-SULFONAMIDOBENZOATE | | CAS: | 59777-72-9 | | MF: | C9H11NO4S | | MW: | 229.25 | | EINECS: | 100-413-0 | | Product Categories: | pharmacetical | | Mol File: | 59777-72-9.mol |  |
| | Ethyl 2-sulfamoylbenzoate Chemical Properties |
| Melting point | 83 °C | | Boiling point | 408.3±47.0 °C(Predicted) | | density | 1.326±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.67±0.60(Predicted) | | form | solid | | color | White | | InChI | InChI=1S/C9H11NO4S/c1-2-14-9(11)7-5-3-4-6-8(7)15(10,12)13/h3-6H,2H2,1H3,(H2,10,12,13) | | InChIKey | CYFKZTWSLPKROH-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C1=CC=CC=C1S(N)(=O)=O | | CAS DataBase Reference | 59777-72-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-(aminosulfonyl)-, ethyl ester (59777-72-9) |
| Hazard Codes | Xi | | TSCA | TSCA listed | | HS Code | 2916399090 |
| | Ethyl 2-sulfamoylbenzoate Usage And Synthesis |
| Chemical Properties | This product is a solid and insoluble in water, but soluble in organic solvents such as alcohol, ether and benzene. | | Uses | Ethyl 2-Sulfamoylbenzoate-d5 is an intermediate in the synthesis of Chlorimuron-ethyl-d5 (C371274), a labeled analogue of Chlorimuron-ethyl (C371273), which is used in weed control method as herbicide. |
| | Ethyl 2-sulfamoylbenzoate Preparation Products And Raw materials |
|